About [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate
[(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate (PubChem CID 10467793) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate.
Molecular Properties
| Compound Name | [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate |
| PubChem CID | 10467793 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate |
| SMILES | C=C1CC[C@H](OC(C)=O)C(C)(C)C12C=CC(=O)C=C2 |
| InChI | InChI=1S/C16H20O3/c1-11-5-6-14(19-12(2)17)15(3,4)16(11)9-7-13(18)8-10-16/h7-10,14H,1,5-6H2,2-4H3/t14-/m0/s1 |
| InChIKey | JRHSCWMJQLIZQY-AWEZNQCLSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate?
The IUPAC name of [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate (CID 10467793) is [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate.
What is the SMILES notation for [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate?
The canonical SMILES for [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate is C=C1CC[C@H](OC(C)=O)C(C)(C)C12C=CC(=O)C=C2.
What is the InChIKey of [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate?
The InChIKey is JRHSCWMJQLIZQY-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H20O3/c1-11-5-6-14(19-12(2)17)15(3,4)16(11)9-7-13(18)8-10-16/h7-10,14H,1,5-6H2,2-4H3/t14-/m0/s1.
What are the key properties of [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate?
[(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate has a molecular weight of 260.33 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-5,5-dimethyl-1-methylidene-9-oxospiro[5.5]undeca-7,10-dien-4-yl] acetate is sourced from PubChem (CID 10467793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).