C14H24N2O3 — CID 104678556
2-[[2-[1-(aminomethyl)cyclohexyl]acetyl]amino]pent-4-enoic acid (PubChem CID 104678556) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[[2-[1-(aminomethyl)cyclohexyl]acetyl]amino]pent-4-enoic acid.
| Compound Name | 2-[[2-[1-(aminomethyl)cyclohexyl]acetyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 104678556 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-[[2-[1-(aminomethyl)cyclohexyl]acetyl]amino]pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)CC1(CN)CCCCC1)C(=O)O |
| InChI | InChI=1S/C14H24N2O3/c1-2-6-11(13(18)19)16-12(17)9-14(10-15)7-4-3-5-8-14/h2,11H,1,3-10,15H2,(H,16,17)(H,18,19) |
| InChIKey | ZMQANFYXKFYZAE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|