C13H17NO2 — CID 104679153
3-[(2-methoxyphenyl)methyl]piperidin-2-one (PubChem CID 104679153) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl]piperidin-2-one.
| Compound Name | 3-[(2-methoxyphenyl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 104679153 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl]piperidin-2-one |
| SMILES | COc1ccccc1CC1CCCNC1=O |
| InChI | InChI=1S/C13H17NO2/c1-16-12-7-3-2-5-10(12)9-11-6-4-8-14-13(11)15/h2-3,5,7,11H,4,6,8-9H2,1H3,(H,14,15) |
| InChIKey | XCQUPSPQEAVPOM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |