About 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one
3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one (PubChem CID 104679409) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one |
| PubChem CID | 104679409 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one |
| SMILES | Cc1cc(CC2CCNC2=O)n(C)n1 |
| InChI | InChI=1S/C10H15N3O/c1-7-5-9(13(2)12-7)6-8-3-4-11-10(8)14/h5,8H,3-4,6H2,1-2H3,(H,11,14) |
| InChIKey | JHVKRZYCTRQSET-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one?
The IUPAC name of 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one (CID 104679409) is 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one?
The canonical SMILES for 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one is Cc1cc(CC2CCNC2=O)n(C)n1.
What is the InChIKey of 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one?
The InChIKey is JHVKRZYCTRQSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-7-5-9(13(2)12-7)6-8-3-4-11-10(8)14/h5,8H,3-4,6H2,1-2H3,(H,11,14).
What are the key properties of 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one?
3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one has a molecular weight of 193.25 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dimethylpyrazol-3-yl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 104679409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).