C15H19NO — CID 104679679
3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)azepan-2-one (PubChem CID 104679679) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)azepan-2-one.
| Compound Name | 3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)azepan-2-one |
|---|---|
| PubChem CID | 104679679 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)azepan-2-one |
| SMILES | O=C1NCCCCC1CC1Cc2ccccc21 |
| InChI | InChI=1S/C15H19NO/c17-15-12(6-3-4-8-16-15)10-13-9-11-5-1-2-7-14(11)13/h1-2,5,7,12-13H,3-4,6,8-10H2,(H,16,17) |
| InChIKey | QLVMRMXRSKPHED-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |