C11H9F5Si — CID 10467969
trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane (PubChem CID 10467969) has the molecular formula C11H9F5Si and a molecular weight of 264.27 g/mol. Its IUPAC name is trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane.
| Compound Name | trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane |
|---|---|
| PubChem CID | 10467969 |
| Molecular Formula | C11H9F5Si |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H9F5Si/c1-17(2,3)5-4-6-7(12)9(14)11(16)10(15)8(6)13/h1-3H3 |
| InChIKey | OHIRKWPMCLVZHL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|