About 2-(2-aminoethyl)nonanoic acid
2-(2-aminoethyl)nonanoic acid (PubChem CID 104680899) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(2-aminoethyl)nonanoic acid.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)nonanoic acid |
| PubChem CID | 104680899 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-(2-aminoethyl)nonanoic acid |
| SMILES | CCCCCCCC(CCN)C(=O)O |
| InChI | InChI=1S/C11H23NO2/c1-2-3-4-5-6-7-10(8-9-12)11(13)14/h10H,2-9,12H2,1H3,(H,13,14) |
| InChIKey | PLVMBGSMIWNCOL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyl)nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)nonanoic acid?
The IUPAC name of 2-(2-aminoethyl)nonanoic acid (CID 104680899) is 2-(2-aminoethyl)nonanoic acid.
What is the SMILES notation for 2-(2-aminoethyl)nonanoic acid?
The canonical SMILES for 2-(2-aminoethyl)nonanoic acid is CCCCCCCC(CCN)C(=O)O.
What is the InChIKey of 2-(2-aminoethyl)nonanoic acid?
The InChIKey is PLVMBGSMIWNCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-2-3-4-5-6-7-10(8-9-12)11(13)14/h10H,2-9,12H2,1H3,(H,13,14).
What are the key properties of 2-(2-aminoethyl)nonanoic acid?
2-(2-aminoethyl)nonanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.40, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)nonanoic acid is sourced from PubChem (CID 104680899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).