C14H22F4 — CID 10468122
(2-cyclohexyl-1,1,2,2-tetrafluoroethyl)cyclohexane (PubChem CID 10468122) has the molecular formula C14H22F4 and a molecular weight of 266.32 g/mol. Its IUPAC name is (2-cyclohexyl-1,1,2,2-tetrafluoroethyl)cyclohexane.
| Compound Name | (2-cyclohexyl-1,1,2,2-tetrafluoroethyl)cyclohexane |
|---|---|
| PubChem CID | 10468122 |
| Molecular Formula | C14H22F4 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (2-cyclohexyl-1,1,2,2-tetrafluoroethyl)cyclohexane |
| SMILES | FC(F)(C1CCCCC1)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C14H22F4/c15-13(16,11-7-3-1-4-8-11)14(17,18)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | FEFMEUWQTYEPPE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|