About spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline]
spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] (PubChem CID 10468139) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline].
Molecular Properties
| Compound Name | spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] |
| PubChem CID | 10468139 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] |
| SMILES | c1ccc2nc3c(cc2c1)CC1(CN2CCC1CC2)O3 |
| InChI | InChI=1S/C17H18N2O/c1-2-4-15-12(3-1)9-13-10-17(20-16(13)18-15)11-19-7-5-14(17)6-8-19/h1-4,9,14H,5-8,10-11H2 |
| InChIKey | ONBISRXFQMIHKY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline]?
The IUPAC name of spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] (CID 10468139) is spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline].
What is the SMILES notation for spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline]?
The canonical SMILES for spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] is c1ccc2nc3c(cc2c1)CC1(CN2CCC1CC2)O3.
What is the InChIKey of spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline]?
The InChIKey is ONBISRXFQMIHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O/c1-2-4-15-12(3-1)9-13-10-17(20-16(13)18-15)11-19-7-5-14(17)6-8-19/h1-4,9,14H,5-8,10-11H2.
What are the key properties of spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline]?
spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] has a molecular weight of 266.34 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]quinoline] is sourced from PubChem (CID 10468139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).