C13H16FNO4 — CID 10468284
benzyl (3R,4S,5S)-3-fluoro-4,5-dihydroxypiperidine-1-carboxylate (PubChem CID 10468284) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is benzyl (3R,4S,5S)-3-fluoro-4,5-dihydroxypiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4S,5S)-3-fluoro-4,5-dihydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10468284 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | benzyl (3R,4S,5S)-3-fluoro-4,5-dihydroxypiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H](F)[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C13H16FNO4/c14-10-6-15(7-11(16)12(10)17)13(18)19-8-9-4-2-1-3-5-9/h1-5,10-12,16-17H,6-8H2/t10-,11+,12-/m1/s1 |
| InChIKey | UVQFFQPZAARFFG-GRYCIOLGSA-N |
| XLogP | 0.70 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |