C10H11N3O4S — CID 10468285
(4S)-4-[(1S)-1-azido-2-phenylethyl]-1,3,2-dioxathiolane 2,2-dioxide (PubChem CID 10468285) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is (4S)-4-[(1S)-1-azido-2-phenylethyl]-1,3,2-dioxathiolane 2,2-dioxide.
| Compound Name | (4S)-4-[(1S)-1-azido-2-phenylethyl]-1,3,2-dioxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 10468285 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (4S)-4-[(1S)-1-azido-2-phenylethyl]-1,3,2-dioxathiolane 2,2-dioxide |
| SMILES | [N-]=[N+]=N[C@@H](Cc1ccccc1)[C@H]1COS(=O)(=O)O1 |
| InChI | InChI=1S/C10H11N3O4S/c11-13-12-9(6-8-4-2-1-3-5-8)10-7-16-18(14,15)17-10/h1-5,9-10H,6-7H2/t9-,10+/m0/s1 |
| InChIKey | QBHWRFJQFRFYNJ-VHSXEESVSA-N |
| XLogP | 1.57 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|