C9H6F5NOS — CID 10468401
2,2,3,3,3-pentafluoro-N-phenylsulfanylpropanamide (PubChem CID 10468401) has the molecular formula C9H6F5NOS and a molecular weight of 271.21 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-phenylsulfanylpropanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 10468401 |
| Molecular Formula | C9H6F5NOS |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-phenylsulfanylpropanamide |
| SMILES | O=C(NSc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NOS/c10-8(11,9(12,13)14)7(16)15-17-6-4-2-1-3-5-6/h1-5H,(H,15,16) |
| InChIKey | NWDSUCUTVUBSSP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|