About 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide
5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide (PubChem CID 104684058) has the molecular formula C14H21N5O
and a molecular weight of 275.36 g/mol. Its IUPAC name is 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide.
Molecular Properties
| Compound Name | 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide |
| PubChem CID | 104684058 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)C(C)CCCN)cc12 |
| InChI | InChI=1S/C14H21N5O/c1-9(5-4-6-15)14(20)17-11-7-12-10(2)18-19(3)13(12)16-8-11/h7-9H,4-6,15H2,1-3H3,(H,17,20) |
| InChIKey | CUFQUNVPENAGQR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide?
The IUPAC name of 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide (CID 104684058) is 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide.
What is the SMILES notation for 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide?
The canonical SMILES for 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide is Cc1nn(C)c2ncc(NC(=O)C(C)CCCN)cc12.
What is the InChIKey of 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide?
The InChIKey is CUFQUNVPENAGQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O/c1-9(5-4-6-15)14(20)17-11-7-12-10(2)18-19(3)13(12)16-8-11/h7-9H,4-6,15H2,1-3H3,(H,17,20).
What are the key properties of 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide?
5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide has a molecular weight of 275.36 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-methylpentanamide is sourced from PubChem (CID 104684058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).