C17H20O3 — CID 10468463
but-3-enyl 3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate (PubChem CID 10468463) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is but-3-enyl 3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate.
| Compound Name | but-3-enyl 3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 10468463 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | but-3-enyl 3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate |
| SMILES | C=CCCOC(=O)CCC1CCc2ccccc2C1=O |
| InChI | InChI=1S/C17H20O3/c1-2-3-12-20-16(18)11-10-14-9-8-13-6-4-5-7-15(13)17(14)19/h2,4-7,14H,1,3,8-12H2 |
| InChIKey | SOFVNOIICAFYHH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|