C13H22O6 — CID 10468569
(2R,3R,4S,5S,6R)-2-(cyclohexen-1-ylmethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10468569) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-(cyclohexen-1-ylmethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-(cyclohexen-1-ylmethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10468569 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-(cyclohexen-1-ylmethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](OCC2=CCCCC2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H22O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h4,9-17H,1-3,5-7H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | OPCXHVPXTXLFFZ-UJPOAAIJSA-N |
| XLogP | -0.70 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|