About N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine
N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine (PubChem CID 10468576) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine |
| PubChem CID | 10468576 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1c([N+](=O)[O-])cnc2ccccc12 |
| InChI | InChI=1S/C14H18N4O2/c1-17(2)9-5-8-15-14-11-6-3-4-7-12(11)16-10-13(14)18(19)20/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | WFSPOGPANMWXTP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine?
The IUPAC name of N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine (CID 10468576) is N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine.
What is the SMILES notation for N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine?
The canonical SMILES for N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine is CN(C)CCCNc1c([N+](=O)[O-])cnc2ccccc12.
What is the InChIKey of N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine?
The InChIKey is WFSPOGPANMWXTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2/c1-17(2)9-5-8-15-14-11-6-3-4-7-12(11)16-10-13(14)18(19)20/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,15,16).
What are the key properties of N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine?
N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine has a molecular weight of 274.32 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N-(3-nitroquinolin-4-yl)propane-1,3-diamine is sourced from PubChem (CID 10468576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).