About 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine
4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (PubChem CID 104685815) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
Molecular Properties
| Compound Name | 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| PubChem CID | 104685815 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| SMILES | CC(C)CCc1noc(C(C)CCCN)n1 |
| InChI | InChI=1S/C12H23N3O/c1-9(2)6-7-11-14-12(16-15-11)10(3)5-4-8-13/h9-10H,4-8,13H2,1-3H3 |
| InChIKey | RKTQUBYWDAKOPD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
The IUPAC name of 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (CID 104685815) is 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
What is the SMILES notation for 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
The canonical SMILES for 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine is CC(C)CCc1noc(C(C)CCCN)n1.
What is the InChIKey of 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
The InChIKey is RKTQUBYWDAKOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-9(2)6-7-11-14-12(16-15-11)10(3)5-4-8-13/h9-10H,4-8,13H2,1-3H3.
What are the key properties of 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine has a molecular weight of 225.34 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine is sourced from PubChem (CID 104685815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).