C12H23N3O — CID 104685815
4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (PubChem CID 104685815) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
| Compound Name | 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 104685815 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-[3-(3-methylbutyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| SMILES | CC(C)CCc1noc(C(C)CCCN)n1 |
| InChI | InChI=1S/C12H23N3O/c1-9(2)6-7-11-14-12(16-15-11)10(3)5-4-8-13/h9-10H,4-8,13H2,1-3H3 |
| InChIKey | RKTQUBYWDAKOPD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |