C12H19F3N4 — CID 104687010
4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentan-1-amine (PubChem CID 104687010) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentan-1-amine.
| Compound Name | 4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 104687010 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pentan-1-amine |
| SMILES | CC(CCCN)c1nnc2n1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C12H19F3N4/c1-8(3-2-6-16)11-18-17-10-5-4-9(7-19(10)11)12(13,14)15/h8-9H,2-7,16H2,1H3 |
| InChIKey | NFGRWBARRBCHEK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |