C17H19NO — CID 104687535
5-ethyl-5-(naphthalen-1-ylmethyl)pyrrolidin-2-one (PubChem CID 104687535) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is 5-ethyl-5-(naphthalen-1-ylmethyl)pyrrolidin-2-one.
| Compound Name | 5-ethyl-5-(naphthalen-1-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 104687535 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 5-ethyl-5-(naphthalen-1-ylmethyl)pyrrolidin-2-one |
| SMILES | CCC1(Cc2cccc3ccccc23)CCC(=O)N1 |
| InChI | InChI=1S/C17H19NO/c1-2-17(11-10-16(19)18-17)12-14-8-5-7-13-6-3-4-9-15(13)14/h3-9H,2,10-12H2,1H3,(H,18,19) |
| InChIKey | QYEAZGAZTHSDGC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |