C13H20N2O — CID 104687921
5-[(1-methylpyrrol-2-yl)methyl]-5-propan-2-ylpyrrolidin-2-one (PubChem CID 104687921) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-[(1-methylpyrrol-2-yl)methyl]-5-propan-2-ylpyrrolidin-2-one.
| Compound Name | 5-[(1-methylpyrrol-2-yl)methyl]-5-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 104687921 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 5-[(1-methylpyrrol-2-yl)methyl]-5-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)C1(Cc2cccn2C)CCC(=O)N1 |
| InChI | InChI=1S/C13H20N2O/c1-10(2)13(7-6-12(16)14-13)9-11-5-4-8-15(11)3/h4-5,8,10H,6-7,9H2,1-3H3,(H,14,16) |
| InChIKey | CXSUEKULMUQOOP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |