C18H24N2 — CID 104688379
6-[[2-(2-methylpropyl)pyrrolidin-2-yl]methyl]quinoline (PubChem CID 104688379) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 6-[[2-(2-methylpropyl)pyrrolidin-2-yl]methyl]quinoline.
| Compound Name | 6-[[2-(2-methylpropyl)pyrrolidin-2-yl]methyl]quinoline |
|---|---|
| PubChem CID | 104688379 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 6-[[2-(2-methylpropyl)pyrrolidin-2-yl]methyl]quinoline |
| SMILES | CC(C)CC1(Cc2ccc3ncccc3c2)CCCN1 |
| InChI | InChI=1S/C18H24N2/c1-14(2)12-18(8-4-10-20-18)13-15-6-7-17-16(11-15)5-3-9-19-17/h3,5-7,9,11,14,20H,4,8,10,12-13H2,1-2H3 |
| InChIKey | CFDPYNJETITTRX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |