C14H20Cl2N2 — CID 104689621
1-[(3,6-dichloro-2-pyridinyl)methyl]-2-ethylazepane (PubChem CID 104689621) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-[(3,6-dichloro-2-pyridinyl)methyl]-2-ethylazepane.
| Compound Name | 1-[(3,6-dichloro-2-pyridinyl)methyl]-2-ethylazepane |
|---|---|
| PubChem CID | 104689621 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-[(3,6-dichloro-2-pyridinyl)methyl]-2-ethylazepane |
| SMILES | CCC1CCCCCN1Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2/c1-2-11-6-4-3-5-9-18(11)10-13-12(15)7-8-14(16)17-13/h7-8,11H,2-6,9-10H2,1H3 |
| InChIKey | HCJUJFZONIHVSU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|