C15H22OS2 — CID 10469004
(8'aR)-3',3',8'a-trimethylspiro[1,3-dithiolane-2,6'-2,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 10469004) has the molecular formula C15H22OS2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (8'aR)-3',3',8'a-trimethylspiro[1,3-dithiolane-2,6'-2,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (8'aR)-3',3',8'a-trimethylspiro[1,3-dithiolane-2,6'-2,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 10469004 |
| Molecular Formula | C15H22OS2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (8'aR)-3',3',8'a-trimethylspiro[1,3-dithiolane-2,6'-2,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CC1(C)CC(=O)[C@]2(C)CCC3(C=C2C1)SCCS3 |
| InChI | InChI=1S/C15H22OS2/c1-13(2)8-11-9-15(17-6-7-18-15)5-4-14(11,3)12(16)10-13/h9H,4-8,10H2,1-3H3/t14-/m1/s1 |
| InChIKey | DKMVBNUFSDEBER-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|