C16H30O2Si — CID 10469006
1-[(4aS,8R,8aS)-4a-methyl-8-trimethylsilyloxy-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]ethanol (PubChem CID 10469006) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is 1-[(4aS,8R,8aS)-4a-methyl-8-trimethylsilyloxy-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]ethanol.
| Compound Name | 1-[(4aS,8R,8aS)-4a-methyl-8-trimethylsilyloxy-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]ethanol |
|---|---|
| PubChem CID | 10469006 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-[(4aS,8R,8aS)-4a-methyl-8-trimethylsilyloxy-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]ethanol |
| SMILES | CC(O)C1=CC[C@]2(C)CCC[C@@H](O[Si](C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C16H30O2Si/c1-12(17)13-8-10-16(2)9-6-7-15(14(16)11-13)18-19(3,4)5/h8,12,14-15,17H,6-7,9-11H2,1-5H3/t12?,14-,15-,16+/m1/s1 |
| InChIKey | DLOVCMYVGWDRQG-SJFVDLKVSA-N |
| XLogP | 4.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|