C17H26N2 — CID 104690100
8-(2-ethylazepan-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 104690100) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 8-(2-ethylazepan-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(2-ethylazepan-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 104690100 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 8-(2-ethylazepan-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCC1CCCCCN1c1cccc2c1NCCC2 |
| InChI | InChI=1S/C17H26N2/c1-2-15-10-4-3-5-13-19(15)16-11-6-8-14-9-7-12-18-17(14)16/h6,8,11,15,18H,2-5,7,9-10,12-13H2,1H3 |
| InChIKey | YLAUSZODNFDQLC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |