C18H29BrN2 — CID 104691933
1-(2-bromophenyl)-3-(2-ethylazepan-1-yl)-N-methylpropan-1-amine (PubChem CID 104691933) has the molecular formula C18H29BrN2 and a molecular weight of 353.35 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(2-ethylazepan-1-yl)-N-methylpropan-1-amine.
| Compound Name | 1-(2-bromophenyl)-3-(2-ethylazepan-1-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 104691933 |
| Molecular Formula | C18H29BrN2 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-(2-bromophenyl)-3-(2-ethylazepan-1-yl)-N-methylpropan-1-amine |
| SMILES | CCC1CCCCCN1CCC(NC)c1ccccc1Br |
| InChI | InChI=1S/C18H29BrN2/c1-3-15-9-5-4-8-13-21(15)14-12-18(20-2)16-10-6-7-11-17(16)19/h6-7,10-11,15,18,20H,3-5,8-9,12-14H2,1-2H3 |
| InChIKey | RIYQNLVNKTXFIF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |