C13H25N7 — CID 104693151
4-(2-ethylazepan-1-yl)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 104693151) has the molecular formula C13H25N7 and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-(2-ethylazepan-1-yl)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-ethylazepan-1-yl)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104693151 |
| Molecular Formula | C13H25N7 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-(2-ethylazepan-1-yl)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CCC1CCCCCN1c1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H25N7/c1-4-10-8-6-5-7-9-20(10)13-16-11(18-14)15-12(17-13)19(2)3/h10H,4-9,14H2,1-3H3,(H,15,16,17,18) |
| InChIKey | OTQIHRCJWCZSFO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|