C14H19N3O3 — CID 104693312
6-[2-(2-methylpyrazol-3-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 104693312) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 6-[2-(2-methylpyrazol-3-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[2-(2-methylpyrazol-3-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104693312 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 6-[2-(2-methylpyrazol-3-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cn1nccc1CCNC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C14H19N3O3/c1-17-10(7-9-16-17)6-8-15-13(18)11-4-2-3-5-12(11)14(19)20/h2-3,7,9,11-12H,4-6,8H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | RFMPNEXFMWLGTH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|