C19H31NO — CID 10469444
cis-(1R,2R)-2-(3-methoxyphenyl)-N,N-dipropylcyclohexan-1-amine (PubChem CID 10469444) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is cis-(1R,2R)-2-(3-methoxyphenyl)-N,N-dipropylcyclohexan-1-amine.
| Compound Name | cis-(1R,2R)-2-(3-methoxyphenyl)-N,N-dipropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10469444 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | cis-(1R,2R)-2-(3-methoxyphenyl)-N,N-dipropylcyclohexan-1-amine |
| SMILES | CCCN(CCC)[C@@H]1CCCC[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C19H31NO/c1-4-13-20(14-5-2)19-12-7-6-11-18(19)16-9-8-10-17(15-16)21-3/h8-10,15,18-19H,4-7,11-14H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | XDYOEMMJCPQPPC-RTBURBONSA-N |
| XLogP | 4.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |