C16H21N3 — CID 104694884
N-[1-(1-ethylpyrazol-4-yl)ethyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 104694884) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is N-[1-(1-ethylpyrazol-4-yl)ethyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[1-(1-ethylpyrazol-4-yl)ethyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 104694884 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-[1-(1-ethylpyrazol-4-yl)ethyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCn1cc(C(C)NC2Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C16H21N3/c1-3-19-11-15(10-17-19)12(2)18-16-8-13-6-4-5-7-14(13)9-16/h4-7,10-12,16,18H,3,8-9H2,1-2H3 |
| InChIKey | BHLFBRQULSYPHQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |