C13H23N3O — CID 104695495
1-[(3,6-dimethylpyrazin-2-yl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 104695495) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-[(3,6-dimethylpyrazin-2-yl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(3,6-dimethylpyrazin-2-yl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 104695495 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-[(3,6-dimethylpyrazin-2-yl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | Cc1cnc(C)c(NCC(O)CC(C)(C)C)n1 |
| InChI | InChI=1S/C13H23N3O/c1-9-7-14-10(2)12(16-9)15-8-11(17)6-13(3,4)5/h7,11,17H,6,8H2,1-5H3,(H,15,16) |
| InChIKey | NMGRNYFEFQSVHC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |