C12H15N5O2S — CID 10469643
5-methylsulfanyl-11-propanoyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 10469643) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 5-methylsulfanyl-11-propanoyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-methylsulfanyl-11-propanoyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 10469643 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 5-methylsulfanyl-11-propanoyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCC(=O)N1CCc2nc3nc(SC)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C12H15N5O2S/c1-3-9(18)16-5-4-8-7(6-16)10(19)17-11(13-8)14-12(15-17)20-2/h3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | BYZLRCOVNZRXHU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |