C12H17N3O3 — CID 104696750
methyl 5-[methyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylate (PubChem CID 104696750) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl 5-[methyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[methyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 104696750 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl 5-[methyl(oxolan-2-ylmethyl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(N(C)CC2CCCO2)cn1 |
| InChI | InChI=1S/C12H17N3O3/c1-15(8-9-4-3-5-18-9)11-7-13-10(6-14-11)12(16)17-2/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | BXTWVXOAOXEKMH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |