C14H10N6O2 — CID 10469679
6,7-di(imidazol-1-yl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 10469679) has the molecular formula C14H10N6O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 6,7-di(imidazol-1-yl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-di(imidazol-1-yl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10469679 |
| Molecular Formula | C14H10N6O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6,7-di(imidazol-1-yl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(-n3ccnc3)c(-n3ccnc3)cc2[nH]c1=O |
| InChI | InChI=1S/C14H10N6O2/c21-13-14(22)18-10-6-12(20-4-2-16-8-20)11(5-9(10)17-13)19-3-1-15-7-19/h1-8H,(H,17,21)(H,18,22) |
| InChIKey | YTNHXHMTXRURHI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|