About 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine
1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine (PubChem CID 10469680) has the molecular formula C11H17F3N4O2
and a molecular weight of 294.28 g/mol. Its IUPAC name is 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine |
| PubChem CID | 10469680 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine |
| SMILES | CCCN(CCC)c1nn(C)c(C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17F3N4O2/c1-4-6-17(7-5-2)10-8(18(19)20)9(11(12,13)14)16(3)15-10/h4-7H2,1-3H3 |
| InChIKey | XXZBQKDUUMOCEA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine?
The IUPAC name of 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine (CID 10469680) is 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine.
What is the SMILES notation for 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine?
The canonical SMILES for 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine is CCCN(CCC)c1nn(C)c(C(F)(F)F)c1[N+](=O)[O-].
What is the InChIKey of 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine?
The InChIKey is XXZBQKDUUMOCEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N4O2/c1-4-6-17(7-5-2)10-8(18(19)20)9(11(12,13)14)16(3)15-10/h4-7H2,1-3H3.
What are the key properties of 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine?
1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine has a molecular weight of 294.28 g/mol, XLogP of 2.97, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitro-N,N-dipropyl-5-(trifluoromethyl)pyrazol-3-amine is sourced from PubChem (CID 10469680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).