About 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one
3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one (PubChem CID 10469706) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one |
| PubChem CID | 10469706 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one |
| SMILES | CCc1cc(/C=C/Cc2nc3ccccc3o2)c(=O)[nH]c1C |
| InChI | InChI=1S/C18H18N2O2/c1-3-13-11-14(18(21)19-12(13)2)7-6-10-17-20-15-8-4-5-9-16(15)22-17/h4-9,11H,3,10H2,1-2H3,(H,19,21)/b7-6+ |
| InChIKey | AEUSETHPHJLJMM-VOTSOKGWSA-N |
| XLogP | 3.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one?
The IUPAC name of 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one (CID 10469706) is 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one.
What is the SMILES notation for 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one?
The canonical SMILES for 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one is CCc1cc(/C=C/Cc2nc3ccccc3o2)c(=O)[nH]c1C.
What is the InChIKey of 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one?
The InChIKey is AEUSETHPHJLJMM-VOTSOKGWSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-3-13-11-14(18(21)19-12(13)2)7-6-10-17-20-15-8-4-5-9-16(15)22-17/h4-9,11H,3,10H2,1-2H3,(H,19,21)/b7-6+.
What are the key properties of 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one?
3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one has a molecular weight of 294.35 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(1,3-benzoxazol-2-yl)prop-1-enyl]-5-ethyl-6-methyl-1H-pyridin-2-one is sourced from PubChem (CID 10469706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).