C11H14ClN5O2 — CID 104697888
[4-(2-chloro-7H-purin-6-yl)-5-methylmorpholin-2-yl]methanol (PubChem CID 104697888) has the molecular formula C11H14ClN5O2 and a molecular weight of 283.72 g/mol. Its IUPAC name is [4-(2-chloro-7H-purin-6-yl)-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(2-chloro-7H-purin-6-yl)-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 104697888 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [4-(2-chloro-7H-purin-6-yl)-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H14ClN5O2/c1-6-4-19-7(3-18)2-17(6)10-8-9(14-5-13-8)15-11(12)16-10/h5-7,18H,2-4H2,1H3,(H,13,14,15,16) |
| InChIKey | MMKQXGWMSBLBFS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |