C15H20O6 — CID 10469826
(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxy-3-prop-2-enyloxolane-2,4-dione (PubChem CID 10469826) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxy-3-prop-2-enyloxolane-2,4-dione.
| Compound Name | (3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxy-3-prop-2-enyloxolane-2,4-dione |
|---|---|
| PubChem CID | 10469826 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-prop-2-enoxy-3-prop-2-enyloxolane-2,4-dione |
| SMILES | C=CCO[C@]1(CC=C)C(=O)O[C@H]([C@@H]2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C15H20O6/c1-5-7-15(18-8-6-2)12(16)11(20-13(15)17)10-9-19-14(3,4)21-10/h5-6,10-11H,1-2,7-9H2,3-4H3/t10-,11+,15-/m0/s1 |
| InChIKey | MCJZRLNABXUNJK-RWSFTLGLSA-N |
| XLogP | 1.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|