C14H18FNO5 — CID 104699220
methyl 5-(3,3-dimethylbutoxy)-2-fluoro-4-nitrobenzoate (PubChem CID 104699220) has the molecular formula C14H18FNO5 and a molecular weight of 299.30 g/mol. Its IUPAC name is methyl 5-(3,3-dimethylbutoxy)-2-fluoro-4-nitrobenzoate.
| Compound Name | methyl 5-(3,3-dimethylbutoxy)-2-fluoro-4-nitrobenzoate |
|---|---|
| PubChem CID | 104699220 |
| Molecular Formula | C14H18FNO5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 5-(3,3-dimethylbutoxy)-2-fluoro-4-nitrobenzoate |
| SMILES | COC(=O)c1cc(OCCC(C)(C)C)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C14H18FNO5/c1-14(2,3)5-6-21-12-7-9(13(17)20-4)10(15)8-11(12)16(18)19/h7-8H,5-6H2,1-4H3 |
| InChIKey | ZUUFDFPKWWZPMX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|