C13H15FN2O5 — CID 104700028
2-fluoro-5-[(3-hydroxycyclobutyl)methyl-methylamino]-4-nitrobenzoic acid (PubChem CID 104700028) has the molecular formula C13H15FN2O5 and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-fluoro-5-[(3-hydroxycyclobutyl)methyl-methylamino]-4-nitrobenzoic acid.
| Compound Name | 2-fluoro-5-[(3-hydroxycyclobutyl)methyl-methylamino]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 104700028 |
| Molecular Formula | C13H15FN2O5 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-fluoro-5-[(3-hydroxycyclobutyl)methyl-methylamino]-4-nitrobenzoic acid |
| SMILES | CN(CC1CC(O)C1)c1cc(C(=O)O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15FN2O5/c1-15(6-7-2-8(17)3-7)11-4-9(13(18)19)10(14)5-12(11)16(20)21/h4-5,7-8,17H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | RFOYMRBDCBQXPU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|