About N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide
N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 10470043) has the molecular formula C15H25NO3S
and a molecular weight of 299.44 g/mol. Its IUPAC name is N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide |
| PubChem CID | 10470043 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | CCCC[C@H](C)[C@H](CO)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H25NO3S/c1-4-5-6-13(3)15(11-17)16-20(18,19)14-9-7-12(2)8-10-14/h7-10,13,15-17H,4-6,11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | GCKDYZFBQYBABE-ZFWWWQNUSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide (CID 10470043) is N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide is CCCC[C@H](C)[C@H](CO)NS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide?
The InChIKey is GCKDYZFBQYBABE-ZFWWWQNUSA-N. The full InChI is InChI=1S/C15H25NO3S/c1-4-5-6-13(3)15(11-17)16-20(18,19)14-9-7-12(2)8-10-14/h7-10,13,15-17H,4-6,11H2,1-3H3/t13-,15-/m0/s1.
What are the key properties of N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide?
N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide has a molecular weight of 299.44 g/mol, XLogP of 2.46, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-1-hydroxy-3-methylheptan-2-yl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 10470043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).