About cycloheptyl 2,5-difluoro-4-nitrobenzoate
cycloheptyl 2,5-difluoro-4-nitrobenzoate (PubChem CID 104700555) has the molecular formula C14H15F2NO4
and a molecular weight of 299.27 g/mol. Its IUPAC name is cycloheptyl 2,5-difluoro-4-nitrobenzoate.
Molecular Properties
| Compound Name | cycloheptyl 2,5-difluoro-4-nitrobenzoate |
| PubChem CID | 104700555 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | cycloheptyl 2,5-difluoro-4-nitrobenzoate |
| SMILES | O=C(OC1CCCCCC1)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C14H15F2NO4/c15-11-8-13(17(19)20)12(16)7-10(11)14(18)21-9-5-3-1-2-4-6-9/h7-9H,1-6H2 |
| InChIKey | IVUUNNVOAYJTAN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cycloheptyl 2,5-difluoro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl 2,5-difluoro-4-nitrobenzoate?
The IUPAC name of cycloheptyl 2,5-difluoro-4-nitrobenzoate (CID 104700555) is cycloheptyl 2,5-difluoro-4-nitrobenzoate.
What is the SMILES notation for cycloheptyl 2,5-difluoro-4-nitrobenzoate?
The canonical SMILES for cycloheptyl 2,5-difluoro-4-nitrobenzoate is O=C(OC1CCCCCC1)c1cc(F)c([N+](=O)[O-])cc1F.
What is the InChIKey of cycloheptyl 2,5-difluoro-4-nitrobenzoate?
The InChIKey is IVUUNNVOAYJTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2NO4/c15-11-8-13(17(19)20)12(16)7-10(11)14(18)21-9-5-3-1-2-4-6-9/h7-9H,1-6H2.
What are the key properties of cycloheptyl 2,5-difluoro-4-nitrobenzoate?
cycloheptyl 2,5-difluoro-4-nitrobenzoate has a molecular weight of 299.27 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl 2,5-difluoro-4-nitrobenzoate is sourced from PubChem (CID 104700555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).