About N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide
N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 104701024) has the molecular formula C12H17ClF3NO2
and a molecular weight of 299.72 g/mol. Its IUPAC name is N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 104701024 |
| Molecular Formula | C12H17ClF3NO2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CCC1CCC(NC(=O)C(F)(F)F)(C(=O)CCl)CC1 |
| InChI | InChI=1S/C12H17ClF3NO2/c1-2-8-3-5-11(6-4-8,9(18)7-13)17-10(19)12(14,15)16/h8H,2-7H2,1H3,(H,17,19) |
| InChIKey | QVIULVCFMOEUIA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide (CID 104701024) is N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide is CCC1CCC(NC(=O)C(F)(F)F)(C(=O)CCl)CC1.
What is the InChIKey of N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide?
The InChIKey is QVIULVCFMOEUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClF3NO2/c1-2-8-3-5-11(6-4-8,9(18)7-13)17-10(19)12(14,15)16/h8H,2-7H2,1H3,(H,17,19).
What are the key properties of N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide?
N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide has a molecular weight of 299.72 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-chloroacetyl)-4-ethylcyclohexyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 104701024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).