C15H25BrO — CID 10470118
(1R,2S,4S)-2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane (PubChem CID 10470118) has the molecular formula C15H25BrO and a molecular weight of 301.27 g/mol. Its IUPAC name is (1R,2S,4S)-2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S)-2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10470118 |
| Molecular Formula | C15H25BrO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (1R,2S,4S)-2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
| SMILES | C/C(=C\CBr)CC[C@H]1C(C)(C)[C@@H]2CC[C@@]1(C)O2 |
| InChI | InChI=1S/C15H25BrO/c1-11(8-10-16)5-6-12-14(2,3)13-7-9-15(12,4)17-13/h8,12-13H,5-7,9-10H2,1-4H3/b11-8+/t12-,13-,15+/m0/s1 |
| InChIKey | JLFAOLQWSDNUEQ-OXXTYPSGSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|