About N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide
N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide (PubChem CID 104701620) has the molecular formula C9H11ClF3NO2
and a molecular weight of 257.64 g/mol. Its IUPAC name is N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 104701620 |
| Molecular Formula | C9H11ClF3NO2 |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCl)CC1(NC(=O)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C9H11ClF3NO2/c10-5-6(15)4-8(2-1-3-8)14-7(16)9(11,12)13/h1-5H2,(H,14,16) |
| InChIKey | MOWGZDHDTOFYEN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide (CID 104701620) is N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide is O=C(CCl)CC1(NC(=O)C(F)(F)F)CCC1.
What is the InChIKey of N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide?
The InChIKey is MOWGZDHDTOFYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClF3NO2/c10-5-6(15)4-8(2-1-3-8)14-7(16)9(11,12)13/h1-5H2,(H,14,16).
What are the key properties of N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide?
N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide has a molecular weight of 257.64 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3-chloro-2-oxopropyl)cyclobutyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 104701620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).