C17H22ClNO3 — CID 104701740
benzyl N-[[1-(2-chloroacetyl)cyclohexyl]methyl]carbamate (PubChem CID 104701740) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is benzyl N-[[1-(2-chloroacetyl)cyclohexyl]methyl]carbamate.
| Compound Name | benzyl N-[[1-(2-chloroacetyl)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 104701740 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | benzyl N-[[1-(2-chloroacetyl)cyclohexyl]methyl]carbamate |
| SMILES | O=C(NCC1(C(=O)CCl)CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C17H22ClNO3/c18-11-15(20)17(9-5-2-6-10-17)13-19-16(21)22-12-14-7-3-1-4-8-14/h1,3-4,7-8H,2,5-6,9-13H2,(H,19,21) |
| InChIKey | HPLUTXIKZLHCFF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|