About 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium
1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium (PubChem CID 10470261) has the molecular formula C12H14NS+
and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium |
| PubChem CID | 10470261 |
| Molecular Formula | C12H14NS+ |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium |
| SMILES | C[N+]1=CC=C(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C12H14NS/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11/h2-7,9H,8,10H2,1H3/q+1 |
| InChIKey | ORPBWNKWGAQWHV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium?
The IUPAC name of 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium (CID 10470261) is 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium.
What is the SMILES notation for 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium?
The canonical SMILES for 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium is C[N+]1=CC=C(Sc2ccccc2)CC1.
What is the InChIKey of 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium?
The InChIKey is ORPBWNKWGAQWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14NS/c1-13-9-7-12(8-10-13)14-11-5-3-2-4-6-11/h2-7,9H,8,10H2,1H3/q+1.
What are the key properties of 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium?
1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium has a molecular weight of 204.32 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-phenylsulfanyl-2,3-dihydropyridin-1-ium is sourced from PubChem (CID 10470261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).