C16H21BrN2O2 — CID 104702895
1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-cyclohexylurea (PubChem CID 104702895) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-cyclohexylurea.
| Compound Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 104702895 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-3-cyclohexylurea |
| SMILES | O=C(NCc1cc(Br)cc2c1OCC2)NC1CCCCC1 |
| InChI | InChI=1S/C16H21BrN2O2/c17-13-8-11-6-7-21-15(11)12(9-13)10-18-16(20)19-14-4-2-1-3-5-14/h8-9,14H,1-7,10H2,(H2,18,19,20) |
| InChIKey | LARSETLRXXCTPI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |