C21H36O — CID 10470323
(2E,6Z,9Z)-2-methylicosa-2,6,9-trienal (PubChem CID 10470323) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (2E,6Z,9Z)-2-methylicosa-2,6,9-trienal.
| Compound Name | (2E,6Z,9Z)-2-methylicosa-2,6,9-trienal |
|---|---|
| PubChem CID | 10470323 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (2E,6Z,9Z)-2-methylicosa-2,6,9-trienal |
| SMILES | CCCCCCCCCC/C=C\C/C=C\CC/C=C(\C)C=O |
| InChI | InChI=1S/C21H36O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(2)20-22/h12-13,15-16,19-20H,3-11,14,17-18H2,1-2H3/b13-12-,16-15-,21-19+ |
| InChIKey | GDOJBHVTKJOBGY-AFKKWEQQSA-N |
| XLogP | 6.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|