C7H10F3N3O3S2 — CID 10470340
3-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-3-ium-7-thiol;trifluoromethanesulfonate (PubChem CID 10470340) has the molecular formula C7H10F3N3O3S2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-3-ium-7-thiol;trifluoromethanesulfonate.
| Compound Name | 3-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-3-ium-7-thiol;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10470340 |
| Molecular Formula | C7H10F3N3O3S2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-3-ium-7-thiol;trifluoromethanesulfonate |
| SMILES | C[n+]1cnc2n1CCC2S.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C6H9N3S.CHF3O3S/c1-8-4-7-6-5(10)2-3-9(6)8;2-1(3,4)8(5,6)7/h4-5H,2-3H2,1H3;(H,5,6,7) |
| InChIKey | BMACOQGIFUFOJO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|